diff --git a/pywafo/src/wafo/numpy_utils.py b/pywafo/src/wafo/numpy_utils.py new file mode 100644 index 0000000..2bcd2c4 --- /dev/null +++ b/pywafo/src/wafo/numpy_utils.py @@ -0,0 +1,2938 @@ +''' +Misc +''' +from __future__ import division +import collections +import sys +import fractions +import numpy as np +from numpy import (abs, amax, any, logical_and, arange, linspace, atleast_1d, + array, asarray, broadcast_arrays, ceil, floor, frexp, hypot, + sqrt, arctan2, sin, cos, exp, log, log1p, mod, diff, finfo, + inf, pi, interp, isnan, isscalar, zeros, ones, linalg, + r_, sign, unique, hstack, vstack, nonzero, where, extract, + meshgrid) +from scipy.special import gammaln +from scipy.integrate import trapz, simps +import warnings +from time import strftime, gmtime + +try: + import c_library as clib # @UnresolvedImport +except: + clib = None +floatinfo = finfo(float) + + +__all__ = ['now', 'spaceline', 'narg_smallest', 'args_flat', 'is_numlike', + 'JITImport', 'DotDict', 'Bunch', 'printf', 'sub_dict_select', + 'parse_kwargs', 'detrendma', 'ecross', 'findcross', 'findextrema', + 'findpeaks', 'findrfc', 'rfcfilter', 'findtp', 'findtc', + 'findoutliers', 'common_shape', 'argsreduce', 'stirlerr', + 'betaloge', 'gravity', 'nextpow2', 'discretize', 'pol2cart', + 'cart2pol', 'meshgrid', 'ndgrid', 'trangood', 'tranproc', + 'plot_histgrm', 'num2pistr', 'test_docstrings', 'lazywhere', + 'valarray'] + + +def valarray(shape, value=np.NaN, typecode=None): + """Return an array of all value. + """ + if typecode is None: + typecode = bool + out = ones(shape, dtype=typecode) * value + + if not isinstance(out, np.ndarray): + out = asarray(out) + return out + + +def piecewise(xi, condlist, funclist, fill_value=0.0, args=(), **kw): + """ + Evaluate a piecewise-defined function. + + Given a set of conditions and corresponding functions, evaluate each + function on the input data wherever its condition is true. + + Parameters + ---------- + xi : tuple + input arguments to the functions in funclist, i.e., (x0, x1,...., xn) + condlist : list of bool arrays + Each boolean array corresponds to a function in `funclist`. Wherever + `condlist[i]` is True, `funclist[i](x0,x1,...,xn)` is used as the + output value. Each boolean array in `condlist` selects a piece of `xi`, + and should therefore be of the same shape as `xi`. + + The length of `condlist` must correspond to that of `funclist`. + If one extra function is given, i.e. if + ``len(funclist) - len(condlist) == 1``, then that extra function + is the default value, used wherever all conditions are false. + funclist : list of callables, f(*(xi + args), **kw), or scalars + Each function is evaluated over `x` wherever its corresponding + condition is True. It should take an array as input and give an array + or a scalar value as output. If, instead of a callable, + a scalar is provided then a constant function (``lambda x: scalar``) is + assumed. + fill_value : scalar + fill value for out of range values. Default 0. + args : tuple, optional + Any further arguments given here passed to the functions + upon execution, i.e., if called ``piecewise(..., ..., args=(1, 'a'))``, + then each function is called as ``f(x0, x1,..., xn, 1, 'a')``. + kw : dict, optional + Keyword arguments used in calling `piecewise` are passed to the + functions upon execution, i.e., if called + ``piecewise(..., ..., lambda=1)``, then each function is called as + ``f(x0, x1,..., xn, lambda=1)``. + + Returns + ------- + out : ndarray + The output is the same shape and type as x and is found by + calling the functions in `funclist` on the appropriate portions of `x`, + as defined by the boolean arrays in `condlist`. Portions not covered + by any condition have undefined values. + + + See Also + -------- + choose, select, where + + Notes + ----- + This is similar to choose or select, except that functions are + evaluated on elements of `xi` that satisfy the corresponding condition from + `condlist`. + + The result is:: + + |-- + |funclist[0](x0[condlist[0]],x1[condlist[0]],...,xn[condlist[0]]) + out = |funclist[1](x0[condlist[1]],x1[condlist[1]],...,xn[condlist[1]]) + |... + |funclist[n2](x0[condlist[n2]],x1[condlist[n2]],...,xn[condlist[n2]]) + |-- + + Examples + -------- + Define the sigma function, which is -1 for ``x < 0`` and +1 for ``x >= 0``. + + >>> x = np.linspace(-2.5, 2.5, 6) + >>> piecewise(x, [x < 0, x >= 0], [-1, 1]) + array([-1., -1., -1., 1., 1., 1.]) + + Define the absolute value, which is ``-x`` for ``x <0`` and ``x`` for + ``x >= 0``. + + >>> piecewise((x,), [x < 0, x >= 0], [lambda x: -x, lambda x: x]) + array([ 2.5, 1.5, 0.5, 0.5, 1.5, 2.5]) + + Define the absolute value, which is ``-x*y`` for ``x*y <0`` and ``x*y`` for + ``x*y >= 0`` + >>> X, Y = np.meshgrid(x, x) + >>> piecewise((X, Y), [X * Y < 0, ], + ... [lambda x, y: -x * y, lambda x, y: x * y]) + array([[ 6.25, 3.75, 1.25, 1.25, 3.75, 6.25], + [ 3.75, 2.25, 0.75, 0.75, 2.25, 3.75], + [ 1.25, 0.75, 0.25, 0.25, 0.75, 1.25], + [ 1.25, 0.75, 0.25, 0.25, 0.75, 1.25], + [ 3.75, 2.25, 0.75, 0.75, 2.25, 3.75], + [ 6.25, 3.75, 1.25, 1.25, 3.75, 6.25]]) + """ + def otherwise_condition(condlist): + return ~np.logical_or.reduce(condlist, axis=0) + + def check_shapes(condlist, funclist): + nc, nf = len(condlist), len(funclist) + if nc not in [nf-1, nf]: + raise ValueError("function list and condition list" + + " must be the same length") + + check_shapes(condlist, funclist) + if not isinstance(xi, tuple): + xi = (xi,) + + condlist = np.broadcast_arrays(*condlist) + if len(condlist) == len(funclist)-1: + condlist.append(otherwise_condition(condlist)) + + arrays = np.broadcast_arrays(*xi) + dtype = np.result_type(*arrays) + + out = valarray(arrays[0].shape, fill_value, dtype) + for cond, func in zip(condlist, funclist): + if isinstance(func, collections.Callable): + temp = tuple(np.extract(cond, arr) for arr in arrays) + args + np.place(out, cond, func(*temp, **kw)) + else: # func is a scalar value + np.place(out, cond, func) + return out + + +def lazywhere(cond, arrays, f, fillvalue=None, f2=None): + """ + np.where(cond, x, fillvalue) always evaluates x even where cond is False. + This one only evaluates f(arr1[cond], arr2[cond], ...). + For example, + >>> a, b = np.array([1, 2, 3, 4]), np.array([5, 6, 7, 8]) + >>> def f(a, b): + return a*b + >>> _lazywhere(a > 2, (a, b), f, np.nan) + array([ nan, nan, 21., 32.]) + + Notice it assumes that all `arrays` are of the same shape, or can be + broadcasted together. + + """ + if fillvalue is None: + if f2 is None: + raise ValueError("One of (fillvalue, f2) must be given.") + else: + fillvalue = np.nan + else: + if f2 is not None: + raise ValueError("Only one of (fillvalue, f2) can be given.") + + arrays = np.broadcast_arrays(*arrays) + temp = tuple(np.extract(cond, arr) for arr in arrays) + out = valarray(np.shape(arrays[0]), value=fillvalue) + np.place(out, cond, f(*temp)) + if f2 is not None: + temp = tuple(np.extract(~cond, arr) for arr in arrays) + np.place(out, ~cond, f2(*temp)) + + return out + + +def rotation_matrix(heading, pitch, roll): + ''' + + Examples + >>> rotation_matrix(heading=0, pitch=0, roll=0) + array([[ 1., 0., 0.], + [ 0., 1., 0.], + [ 0., 0., 1.]]) + + >>> np.all(np.abs(rotation_matrix(heading=180, pitch=0, roll=0)- + ... array([[ -1.000000e+00, -1.224647e-16, 0.000000e+00], + ... [ 1.224647e-16, -1.000000e+00, 0.000000e+00], + ... [ -0.000000e+00, 0.000000e+00, 1.000000e+00]]))<1e-7) + True + >>> np.all(np.abs(rotation_matrix(heading=0, pitch=180, roll=0)- + ... array([[ -1.000000e+00, 0.000000e+00, 1.224647e-16], + ... [ -0.000000e+00, 1.000000e+00, 0.000000e+00], + ... [ -1.224647e-16, -0.000000e+00, -1.000000e+00]]))<1e-7) + True + >>> np.all(np.abs(rotation_matrix(heading=0, pitch=0, roll=180)- + ... array([[ 1.000000e+00, 0.000000e+00, 0.000000e+00], + ... [ 0.000000e+00, -1.000000e+00, -1.224647e-16], + ... [ -0.000000e+00, 1.224647e-16, -1.000000e+00]]))<1e-7) + True + ''' + data = np.diag(np.ones(3)) # No transform if H=P=R=0 + if heading != 0 or pitch != 0 or roll != 0: + deg2rad = np.pi / 180 + H = heading * deg2rad + P = pitch * deg2rad + R = roll * deg2rad # Convert to radians + + data.put(0, cos(H) * cos(P)) + data.put(1, cos(H) * sin(P) * sin(R) - sin(H) * cos(R)) + data.put(2, cos(H) * sin(P) * cos(R) + sin(H) * sin(R)) + data.put(3, sin(H) * cos(P)) + data.put(4, sin(H) * sin(P) * sin(R) + cos(H) * cos(R)) + data.put(5, sin(H) * sin(P) * cos(R) - cos(H) * sin(R)) + data.put(6, -sin(P)) + data.put(7, cos(P) * sin(R)) + data.put(8, cos(P) * cos(R)) + return data + + +def rotate(x, y, z, heading=0, pitch=0, roll=0): + rot_param = rotation_matrix(heading, pitch, roll).ravel() + X = x * rot_param[0] + y * rot_param[1] + z * rot_param[2] + Y = x * rot_param[3] + y * rot_param[4] + z * rot_param[5] + Z = x * rot_param[6] + y * rot_param[7] + z * rot_param[8] + return X, Y, Z + + +def rotate_2d(x, y, angle_deg): + ''' + Rotate points in the xy cartesian plane counter clockwise + + Examples + -------- + >>> rotate_2d(x=1, y=0, angle_deg=0) + (1.0, 0.0) + >>> rotate_2d(x=1, y=0, angle_deg=90) + (6.123233995736766e-17, 1.0) + >>> rotate_2d(x=1, y=0, angle_deg=180) + (-1.0, 1.2246467991473532e-16) + >>> rotate_2d(x=1, y=0, angle_deg=360) + (1.0, -2.4492935982947064e-16) + ''' + angle_rad = angle_deg * pi / 180 + ch = cos(angle_rad) + sh = sin(angle_rad) + return ch * x - sh * y, sh * x + ch * y + + +def now(show_seconds=True): + ''' + Return current date and time as a string + ''' + if show_seconds: + return strftime("%a, %d %b %Y %H:%M:%S", gmtime()) + else: + return strftime("%a, %d %b %Y %H:%M", gmtime()) + + +def _assert(cond, txt=''): + if not cond: + raise ValueError(txt) + + +def spaceline(start_point, stop_point, num=10): + '''Return `num` evenly spaced points between the start and stop points. + + Parameters + ---------- + start_point : vector, size=3 + The starting point of the sequence. + stop_point : vector, size=3 + The end point of the sequence. + num : int, optional + Number of samples to generate. Default is 10. + + Returns + ------- + space_points : ndarray of shape n x 3 + There are `num` equally spaced points in the closed interval + ``[start, stop]``. + + See Also + -------- + linspace : similar to spaceline, but in 1D. + arange : Similiar to `linspace`, but uses a step size (instead of the + number of samples). + logspace : Samples uniformly distributed in log space. + + Example + ------- + >>> import utilities.numpy_utils as pm + >>> pm.spaceline((2,0,0), (3,0,0), num=5) + array([[ 2. , 0. , 0. ], + [ 2.25, 0. , 0. ], + [ 2.5 , 0. , 0. ], + [ 2.75, 0. , 0. ], + [ 3. , 0. , 0. ]]) + + ''' + num = int(num) + e1, e2 = np.atleast_1d(start_point, stop_point) + e2m1 = e2 - e1 + length = np.sqrt((e2m1 ** 2).sum()) + # length = sqrt((E2[0]-E1(1))^2 + (E2(2)-E1(2))^2 + (E2(3)-E1(3))^2); + C = e2m1 / length + delta = length / float(num - 1) + return np.array([e1 + n * delta * C for n in range(num)]) + + +def narg_smallest(n, arr): + ''' Return the n smallest indicis to the arr + ''' + return np.array(arr).argsort()[:n] + + +def args_flat(*args): + ''' + Return x,y,z positions as a N x 3 ndarray + + Parameters + ---------- + pos : array-like, shape N x 3 + [x,y,z] positions + or + + x,y,z : array-like + [x,y,z] positions + + Returns + ------ + pos : ndarray, shape N x 3 + [x,y,z] positions + common_shape : None or tuple + common shape of x, y and z variables if given as triple input. + + Examples + -------- + >>> x = [1,2,3] + >>> pos, c_shape =args_flat(x,2,3) + >>> pos + array([[1, 2, 3], + [2, 2, 3], + [3, 2, 3]]) + >>> c_shape + (3,) + >>> pos1, c_shape1 = args_flat([1,2,3]) + >>> pos1 + array([[1, 2, 3]]) + >>> c_shape1 is None + True + >>> pos1, c_shape1 = args_flat(1,2,3) + >>> pos1 + array([[1, 2, 3]]) + >>> c_shape1 + () + >>> pos1, c_shape1 = args_flat([1],2,3) + >>> pos1 + array([[1, 2, 3]]) + >>> c_shape1 + (1,) + + ''' + nargin = len(args) + + if (nargin == 1): # pos + pos = np.atleast_2d(args[0]) + _assert((pos.shape[1] == 3) and (pos.ndim == 2), + 'POS array must be of shape N x 3!') + return pos, None + elif nargin == 3: + x, y, z = broadcast_arrays(*args[:3]) + c_shape = x.shape + return np.vstack((x.ravel(), y.ravel(), z.ravel())).T, c_shape + else: + raise ValueError('Number of arguments must be 1 or 3!') + + +def _check_and_adjust_shape(shape, nsub=None): + s = np.atleast_1d(shape) + ndim = len(s) + if ndim < 1: + raise ValueError('Shape vector must have at least 1 element.') + ndim = len(s) + if nsub is None: + nsub = ndim + if ndim <= nsub: # add trailing singleton dimensions + s = np.hstack([s, np.ones(nsub - ndim, dtype=int)]) + else: # Adjust for linear indexing on last element + s = np.hstack([s[:nsub - 1], np.prod(s[nsub - 1:])]) + return s + + +def _sub2index_factor(shape, order='C'): + ''' Return multiplier needed for calculating linear index + from multiple subscripts. + ''' + step = 1 if order == 'F' else -1 # C order + return np.hstack([1, np.cumprod(shape[::step][:-1])])[::step] + + +def index2sub(shape, index, nsub=None, order='C'): + ''' + Returns Multiple subscripts from linear index. + + Parameters + ---------- + shape : array-like + shape of array + index : + linear index into array + nsub : int optional + Number of subscripts returned. default nsub=len(shape) + order : {'C','F'}, optional + The order of the linear index. + 'C' means C (row-major) order. + 'F' means Fortran (column-major) order. + By default, 'C' order is used. + + This function is used to determine the equivalent subscript values + corresponding to a given single index into an array. + + Example + ------- + >>> shape = (3,3,4) + >>> a = np.arange(np.prod(shape)).reshape(shape) + >>> order = 'C' + >>> a[1, 2, 3] + 23 + >>> i = sub2index(shape, 1, 2, 3, order=order) + >>> a.ravel(order)[i] + 23 + >>> index2sub(shape, i, order=order) + (array([1]), array([2]), array([3])) + + See also + -------- + sub2index + ''' + ndx = np.atleast_1d(index) + s = _check_and_adjust_shape(shape, nsub) + k = _sub2index_factor(s, order) + n = len(s) + step = -1 if order == 'F' else 1 # C order + subscripts = [0, ] * n + for i in range(n)[::step]: + vi = np.remainder(ndx, k[i]) + subscript = np.array((ndx - vi) / k[i], dtype=int) + subscripts[i] = subscript + ndx = vi + return tuple(subscripts) + + +def sub2index(shape, *subscripts, **kwds): + ''' + Returns linear index from multiple subscripts. + + Parameters + ---------- + shape : array-like + shape of array + *subscripts : + subscripts into array + order : {'C','F'}, optional + The order of the linear index. + 'C' means C (row-major) order. + 'F' means Fortran (column-major) order. + By default, 'C' order is used. + + This function is used to determine the equivalent single index + corresponding to a given set of subscript values into an array. + + Example + ------- + >>> shape = (3,3,4) + >>> a = np.arange(np.prod(shape)).reshape(shape) + >>> order = 'C' + >>> i = sub2index(shape, 1, 2, 3, order=order) + >>> a[1, 2, 3] + 23 + >>> a.ravel(order)[i] + 23 + >>> index2sub(shape, i, order=order) + (array([1]), array([2]), array([3])) + + See also + -------- + index2sub + ''' + nsub = len(subscripts) + s = _check_and_adjust_shape(shape, nsub) + k = _sub2index_factor(s, **kwds) + + ndx = 0 + s0 = np.shape(subscripts[0]) + for i, subscript in enumerate(subscripts): + np.testing.assert_equal(s0, np.shape(subscript), + 'The subscripts vectors must all ' + + 'be of the same shape.') + if (np.any(subscript < 0)) or (np.any(s[i] <= subscript)): + raise IndexError('Out of range subscript.') + + ndx = ndx + k[i] * subscript + return ndx + + +def is_numlike(obj): + 'return true if *obj* looks like a number' + try: + obj + 1 + except TypeError: + return False + else: + return True + + +class JITImport(object): + + ''' + Just In Time Import of module + + Example + ------- + >>> np = JITImport('numpy') + >>> np.exp(0)==1.0 + True + ''' + + def __init__(self, module_name): + self._module_name = module_name + self._module = None + + def __getattr__(self, attr): + try: + return getattr(self._module, attr) + except: + if self._module is None: + self._module = __import__(self._module_name, None, None, ['*']) + # assert(isinstance(self._module, types.ModuleType), 'module') + return getattr(self._module, attr) + else: + raise + + +class DotDict(dict): + + ''' Implement dot access to dict values + + Example + ------- + >>> d = DotDict(test1=1,test2=3) + >>> d.test1 + 1 + ''' + __getattr__ = dict.__getitem__ + + +class Bunch(object): + + ''' Implement keyword argument initialization of class + + Example + ------- + >>> d = Bunch(test1=1,test2=3) + >>> d.test1 + 1 + ''' + + def __init__(self, **kwargs): + self.__dict__.update(kwargs) + + def keys(self): + return self.__dict__.keys() + + def update(self, ** kwargs): + self.__dict__.update(kwargs) + + +def printf(format, *args): # @ReservedAssignment + sys.stdout.write(format % args) + + +def sub_dict_select(somedict, somekeys): + ''' + Extracting a Subset from Dictionary + + Example + -------- + # Update options dict from keyword arguments if + # the keyword exists in options + >>> opt = dict(arg1=2, arg2=3) + >>> kwds = dict(arg2=100,arg3=1000) + >>> sub_dict = sub_dict_select(kwds,opt.keys()) + >>> opt.update(sub_dict) + >>> opt + {'arg1': 2, 'arg2': 100} + + See also + -------- + dict_intersection + ''' + # slower: validKeys = set(somedict).intersection(somekeys) + return dict((k, somedict[k]) for k in somekeys if k in somedict) + + +def parse_kwargs(options, **kwargs): + ''' + Update options dict from keyword arguments if the keyword exists in options + + Example + >>> opt = dict(arg1=2, arg2=3) + >>> opt = parse_kwargs(opt,arg2=100) + >>> print opt + {'arg1': 2, 'arg2': 100} + >>> opt2 = dict(arg2=101) + >>> opt = parse_kwargs(opt,**opt2) + + See also sub_dict_select + ''' + + newopts = sub_dict_select(kwargs, options.keys()) + if len(newopts) > 0: + options.update(newopts) + return options + + +def testfun(*args, **kwargs): + opts = dict(opt1=1, opt2=2) + if (len(args) == 1 and len(kwargs) == 0 and isinstance(args[0], str) and + args[0].startswith('default')): + return opts + opts = parse_kwargs(opts, **kwargs) + return opts + + +def detrendma(x, L): + """ + Removes a trend from data using a moving average + of size 2*L+1. If 2*L+1 > len(x) then the mean is removed + + Parameters + ---------- + x : vector or matrix of column vectors + of data + L : scalar, integer + defines the size of the moving average window + + Returns + ------- + y : ndarray + detrended data + + Examples + -------- + >>> import pylab as plt + >>> exp = plt.exp; cos = plt.cos; randn = plt.randn + >>> x = plt.linspace(0,1,200) + >>> y = exp(x)+cos(5*2*pi*x)+1e-1*randn(x.size) + >>> y0 = detrendma(y,20); tr = y-y0 + >>> h = plt.plot(x, y, x, y0, 'r', x, exp(x), 'k', x, tr, 'm') + >>> plt.close('all') + + See also + -------- + Reconstruct + """ + + if L <= 0: + raise ValueError('L must be positive') + if L != round(L): + raise ValueError('L must be an integer') + + x1 = np.atleast_1d(x) + if x1.shape[0] == 1: + x1 = x1.ravel() + + n = x1.shape[0] + if n < 2 * L + 1: # only able to remove the mean + return x1 - x1.mean(axis=0) + + mn = x1[0:2 * L + 1].mean(axis=0) + y = np.empty_like(x1) + y[0:L] = x1[0:L] - mn + + ix = np.r_[L:(n - L)] + trend = ((x1[ix + L] - x1[ix - L]) / (2 * L + 1)).cumsum(axis=0) + mn + y[ix] = x1[ix] - trend + y[n - L::] = x1[n - L::] - trend[-1] + return y + + +def ecross(t, f, ind, v=0): + ''' + Extracts exact level v crossings + + ECROSS interpolates t and f linearly to find the exact level v + crossings, i.e., the points where f(t0) = v + + Parameters + ---------- + t,f : vectors + of arguments and functions values, respectively. + ind : ndarray of integers + indices to level v crossings as found by findcross. + v : scalar or vector (of size(ind)) + defining the level(s) to cross. + + Returns + ------- + t0 : vector + of exact level v crossings. + + Example + ------- + >>> from matplotlib import pylab as plt + >>> import utilities.numpy_utils as wm + >>> ones = np.ones + >>> t = np.linspace(0,7*np.pi,250) + >>> x = np.sin(t) + >>> ind = wm.findcross(x,0.75) + >>> ind + array([ 9, 25, 80, 97, 151, 168, 223, 239]) + >>> t0 = wm.ecross(t,x,ind,0.75) + >>> np.abs(t0 - np.array([ 0.84910514, 2.2933879, 7.13205663, 8.57630119, + ... 13.41484739, 14.85909194, 19.69776067, 21.14204343]))<1e-7 + array([ True, True, True, True, True, True, True, True], dtype=bool) + + >>> a = plt.plot(t, x, '.', t[ind], x[ind], 'r.', t, ones(t.shape)*0.75, + ... t0, ones(t0.shape)*0.75, 'g.') + >>> plt.close('all') + + See also + -------- + findcross + ''' + # Tested on: Python 2.5 + # revised pab Feb2004 + # By pab 18.06.2001 + return t[ind] + (v - f[ind]) * (t[ind + 1] - t[ind]) / \ + (f[ind + 1] - f[ind]) + + +def _findcross(xn): + '''Return indices to zero up and downcrossings of a vector + ''' + if clib is not None: + ind, m = clib.findcross(xn, 0.0) + return ind[:m] + + n = len(xn) + iz, = (xn == 0).nonzero() + if len(iz) > 0: + # Trick to avoid turning points on the crossinglevel. + if iz[0] == 0: + if len(iz) == n: + warnings.warn('All values are equal to crossing level!') + return zeros(0, dtype=np.int) + + diz = diff(iz) + if len(diz) > 0 and (diz > 1).any(): + ix = iz[(diz > 1).argmax()] + else: + ix = iz[-1] + + # x(ix) is a up crossing if x(1:ix) = v and x(ix+1) > v. + # x(ix) is a downcrossing if x(1:ix) = v and x(ix+1) < v. + xn[0:ix + 1] = -xn[ix + 1] + iz = iz[ix + 1::] + + for ix in iz.tolist(): + xn[ix] = xn[ix - 1] + + # indices to local level crossings ( without turningpoints) + ind, = (xn[:n - 1] * xn[1:] < 0).nonzero() + return ind + + +def findcross(x, v=0.0, kind=None): + ''' + Return indices to level v up and/or downcrossings of a vector + + Parameters + ---------- + x : array_like + vector with sampled values. + v : scalar, real + level v. + kind : string + defines type of wave or crossing returned. Possible options are + 'dw' : downcrossing wave + 'uw' : upcrossing wave + 'cw' : crest wave + 'tw' : trough wave + 'd' : downcrossings only + 'u' : upcrossings only + None : All crossings will be returned + + Returns + ------- + ind : array-like + indices to the crossings in the original sequence x. + + Example + ------- + >>> from matplotlib import pylab as plt + >>> import utilities.numpy_utils as wm + >>> ones = np.ones + >>> findcross([0, 1, -1, 1],0) + array([0, 1, 2]) + >>> v = 0.75 + >>> t = np.linspace(0,7*np.pi,250) + >>> x = np.sin(t) + >>> ind = wm.findcross(x,v) # all crossings + >>> ind + array([ 9, 25, 80, 97, 151, 168, 223, 239]) + + >>> t0 = plt.plot(t,x,'.',t[ind],x[ind],'r.', t, ones(t.shape)*v) + >>> ind2 = wm.findcross(x,v,'u') + >>> ind2 + array([ 9, 80, 151, 223]) + + >>> t0 = plt.plot(t[ind2],x[ind2],'o') + >>> plt.close('all') + + See also + -------- + crossdef + wavedef + ''' + xn = np.int8(sign(atleast_1d(x).ravel() - v)) # @UndefinedVariable + ind = _findcross(xn) + if ind.size == 0: + warnings.warn('No level v = %0.5g crossings found in x' % v) + return ind + + if kind not in ('du', 'all', None): + if kind == 'd': # downcrossings only + t_0 = int(xn[ind[0] + 1] > 0) + ind = ind[t_0::2] + elif kind == 'u': # upcrossings only + t_0 = int(xn[ind[0] + 1] < 0) + ind = ind[t_0::2] + elif kind in ('dw', 'uw', 'tw', 'cw'): + # make sure that the first is a level v down-crossing + # if kind=='dw' or kind=='tw' + # or that the first is a level v up-crossing + # if kind=='uw' or kind=='cw' + xor = lambda a, b: a ^ b + first_is_down_crossing = int(xn[ind[0]] > xn[ind[0] + 1]) + if xor(first_is_down_crossing, kind in ('dw', 'tw')): + ind = ind[1::] + + n_c = ind.size # number of level v crossings + # make sure the number of troughs and crests are according to the + # wavedef, i.e., make sure length(ind) is odd if dw or uw + # and even if tw or cw + is_odd = mod(n_c, 2) + if xor(is_odd, kind in ('dw', 'uw')): + ind = ind[:-1] + else: + raise ValueError('Unknown wave/crossing definition!') + return ind + + +def findextrema(x): + ''' + Return indices to minima and maxima of a vector + + Parameters + ---------- + x : vector with sampled values. + + Returns + ------- + ind : indices to minima and maxima in the original sequence x. + + Examples + -------- + >>> import numpy as np + >>> import pylab as plt + >>> import utilities.numpy_utils as wm + >>> t = np.linspace(0,7*np.pi,250) + >>> x = np.sin(t) + >>> ind = wm.findextrema(x) + + >>> a = plt.plot(t,x,'.',t[ind],x[ind],'r.') + >>> plt.close('all') + + See also + -------- + findcross + crossdef + ''' + xn = atleast_1d(x).ravel() + return findcross(diff(xn), 0.0) + 1 + + +def findpeaks(data, n=2, min_h=None, min_p=0.0): + ''' + Find peaks of vector or matrix possibly rainflow filtered + + Parameters + ---------- + data = matrix or vector + n = The n highest peaks are found (if exist). (default 2) + min_h = The threshold in the rainflowfilter (default 0.05*range(S(:))). + A zero value will return all the peaks of S. + min_p = 0..1, Only the peaks that are higher than + min_p*max(max(S)) min_p*(the largest peak in S) + are returned (default 0). + Returns + ix = + linear index to peaks of S + + Example: + + Find highest 8 peaks that are not + less that 0.3*"global max" and have + rainflow amplitude larger than 5. + >>> import numpy as np + >>> import utilities.numpy_utils as wm + >>> x = np.arange(0,10,0.01) + >>> data = x**2+10*np.sin(3*x)+0.5*np.sin(50*x) + >>> wm.findpeaks(data, n=8, min_h=5, min_p=0.3) + array([908, 694, 481]) + + See also + -------- + findtp + ''' + S = np.atleast_1d(data) + smax = S.max() + if min_h is None: + smin = S.min() + min_h = 0.05 * (smax - smin) + ndim = S.ndim + S = np.atleast_2d(S) + nrows, mcols = S.shape + + # Finding turningpoints of the spectrum + # Returning only those with rainflowcycle heights greater than h_min + indP = [] # indices to peaks + ind = [] + for iy in range(nrows): # % find all peaks + TuP = findtp(S[iy], min_h) + if len(TuP): + ind = TuP[1::2] # ; % extract indices to maxima only + else: # % did not find any , try maximum + ind = np.atleast_1d(S[iy].argmax()) + + if ndim > 1: + if iy == 0: + ind2 = np.flatnonzero(S[iy, ind] > S[iy + 1, ind]) + elif iy == nrows - 1: + ind2 = np.flatnonzero(S[iy, ind] > S[iy - 1, ind]) + else: + ind2 = np.flatnonzero((S[iy, ind] > S[iy - 1, ind]) & + (S[iy, ind] > S[iy + 1, ind])) + + if len(ind2): + indP.append((ind[ind2] + iy * mcols)) + + if ndim > 1: + ind = np.hstack(indP) if len(indP) else [] + if len(ind) == 0: + return [] + + peaks = S.take(ind) + ind2 = peaks.argsort()[::-1] + + # keeping only the Np most significant peak frequencies. + nmax = min(n, len(ind)) + ind = ind[ind2[:nmax]] + if (min_p > 0): + # Keeping only peaks larger than min_p percent relative to the maximum + # peak + ind = ind[(S.take(ind) > min_p * smax)] + + return ind + + +def findrfc_astm(tp): + """ + Return rainflow counted cycles + + Nieslony's Matlab implementation of the ASTM standard practice for rainflow + counting ported to a Python C module. + + Parameters + ---------- + tp : array-like + vector of turningpoints (NB! Only values, not sampled times) + + Returns + ------- + sig_rfc : array-like + array of shape (n,3) with: + sig_rfc[:,0] Cycles amplitude + sig_rfc[:,1] Cycles mean value + sig_rfc[:,2] Cycle type, half (=0.5) or full (=1.0) + """ + + y1 = atleast_1d(tp).ravel() + sig_rfc, cnr = clib.findrfc3_astm(y1) + # the sig_rfc was constructed too big in rainflow.rf3, so + # reduce the sig_rfc array as done originally by a matlab mex c function + n = len(sig_rfc) + sig_rfc = sig_rfc.__getslice__(0, n - cnr[0]) + # sig_rfc holds the actual rainflow counted cycles, not the indices + return sig_rfc + + +def findrfc(tp, hmin=0.0, method='clib'): + ''' + Return indices to rainflow cycles of a sequence of TP. + + Parameters + ----------- + tp : array-like + vector of turningpoints (NB! Only values, not sampled times) + h : real scalar + rainflow threshold. If h>0, then all rainflow cycles with height + smaller than h are removed. + method : string, optional + 'clib' 'None' + Specify 'clib' for calling the c_functions, otherwise fallback to + the Python implementation. + + Returns + ------- + ind : ndarray of int + indices to the rainflow cycles of the original sequence TP. + + Example: + -------- + >>> import pylab as plt + >>> import utilities.numpy_utils as wm + >>> t = plt.linspace(0,7*np.pi,250) + >>> x = plt.sin(t)+0.1*np.sin(50*t) + >>> ind = wm.findextrema(x) + >>> ti, tp = t[ind], x[ind] + + >>> a = plt.plot(t,x,'.',ti,tp,'r.') + >>> ind1 = wm.findrfc(tp,0.3); ind1 + array([ 0, 9, 32, 53, 74, 95, 116, 137]) + + >>> a = plt.plot(ti[ind1],tp[ind1]) + >>> plt.close('all') + + See also + -------- + rfcfilter, + findtp. + ''' + # TODO: merge rfcfilter and findrfc + y1 = atleast_1d(tp).ravel() + + n = len(y1) + ind = zeros(0, dtype=np.int) + ix = 0 + if y1[0] > y1[1]: + # first is a max, ignore it + y = y1[1::] + NC = floor((n - 1) / 2) - 1 + Tstart = 1 + else: + y = y1 + NC = floor(n / 2) - 1 + Tstart = 0 + + if (NC < 1): + return ind # No RFC cycles*/ + + if (y[0] > y[1]) and (y[1] > y[2]): + warnings.warn('This is not a sequence of turningpoints, exit') + return ind + + if (y[0] < y[1]) and (y[1] < y[2]): + warnings.warn('This is not a sequence of turningpoints, exit') + return ind + + if clib is None or method not in ('clib'): + ind = zeros(n, dtype=np.int) + NC = np.int(NC) + for i in xrange(NC): + Tmi = Tstart + 2 * i + Tpl = Tstart + 2 * i + 2 + xminus = y[2 * i] + xplus = y[2 * i + 2] + + if(i != 0): + j = i - 1 + while ((j >= 0) and (y[2 * j + 1] <= y[2 * i + 1])): + if (y[2 * j] < xminus): + xminus = y[2 * j] + Tmi = Tstart + 2 * j + j -= 1 + if (xminus >= xplus): + if (y[2 * i + 1] - xminus >= hmin): + ind[ix] = Tmi + ix += 1 + ind[ix] = (Tstart + 2 * i + 1) + ix += 1 + # goto L180 continue + else: + j = i + 1 + while (j < NC): + if (y[2 * j + 1] >= y[2 * i + 1]): + break # goto L170 + if((y[2 * j + 2] <= xplus)): + xplus = y[2 * j + 2] + Tpl = (Tstart + 2 * j + 2) + j += 1 + else: + if ((y[2 * i + 1] - xminus) >= hmin): + ind[ix] = Tmi + ix += 1 + ind[ix] = (Tstart + 2 * i + 1) + ix += 1 + # iy = i + continue + + # goto L180 + # L170: + if (xplus <= xminus): + if ((y[2 * i + 1] - xminus) >= hmin): + ind[ix] = Tmi + ix += 1 + ind[ix] = (Tstart + 2 * i + 1) + ix += 1 + elif ((y[2 * i + 1] - xplus) >= hmin): + ind[ix] = (Tstart + 2 * i + 1) + ix += 1 + ind[ix] = Tpl + ix += 1 + + # L180: + # iy=i + # /* for i */ + else: + ind, ix = clib.findrfc(y, hmin) + return np.sort(ind[:ix]) + + +def mctp2rfc(fmM, fMm=None): + ''' + Return Rainflow matrix given a Markov chain of turning points + + computes f_rfc = f_mM + F_mct(f_mM). + + Parameters + ---------- + fmM = the min2max Markov matrix, + fMm = the max2min Markov matrix, + + Returns + ------- + f_rfc = the rainflow matrix, + + Example: + ------- + >>> fmM = np.array([[ 0.0183, 0.0160, 0.0002, 0.0000, 0], + ... [0.0178, 0.5405, 0.0952, 0, 0], + ... [0.0002, 0.0813, 0, 0, 0], + ... [0.0000, 0, 0, 0, 0], + ... [ 0, 0, 0, 0, 0]]) + + >>> np.abs(mctp2rfc(fmM)-np.array([[2.669981e-02, 7.799700e-03, + ... 4.906077e-07, 0.000000e+00, 0.000000e+00], + ... [ 9.599629e-03, 5.485009e-01, 9.539951e-02, 0.000000e+00, + ... 0.000000e+00], + ... [ 5.622974e-07, 8.149944e-02, 0.000000e+00, 0.000000e+00, + ... 0.000000e+00], + ... [ 0.000000e+00, 0.000000e+00, 0.000000e+00, 0.000000e+00, + ... 0.000000e+00], + ... [ 0.000000e+00, 0.000000e+00, 0.000000e+00, 0.000000e+00, + ... 0.000000e+00]]))<1.e-7 + array([[ True, True, True, True, True], + [ True, True, True, True, True], + [ True, True, True, True, True], + [ True, True, True, True, True], + [ True, True, True, True, True]], dtype=bool) + ''' + + if fMm is None: + fmM = np.atleast_1d(fmM) + fMm = fmM.copy() + else: + fmM, fMm = np.atleast_1d(fmM, fMm) + f_mM, f_Mm = fmM.copy(), fMm.copy() + N = max(f_mM.shape) + f_max = np.sum(f_mM, axis=1) + f_min = np.sum(f_mM, axis=0) + f_rfc = zeros((N, N)) + f_rfc[N - 2, 0] = f_max[N - 2] + f_rfc[0, N - 2] = f_min[N - 2] + for k in range(2, N - 1): + for i in range(1, k): + AA = f_mM[N - 1 - k:N - 1 - k + i, k - i:k] + AA1 = f_Mm[N - 1 - k:N - 1 - k + i, k - i:k] + RAA = f_rfc[N - 1 - k:N - 1 - k + i, k - i:k] + nA = max(AA.shape) + MA = f_max[N - 1 - k:N - 1 - k + i] + mA = f_min[k - i:k] + SA = AA.sum() + SRA = RAA.sum() + + DRFC = SA - SRA + NT = min(mA[0] - sum(RAA[:, 0]), MA[0] - sum(RAA[0, :])) # check! + NT = max(NT, 0) # ??check + + if NT > 1e-6 * max(MA[0], mA[0]): + NN = MA - np.sum(AA, axis=1) # T + e = (mA - np.sum(AA, axis=0)) # T + e = np.flipud(e) + PmM = np.rot90(AA.copy()) + for j in range(nA): + norm = mA[nA - 1 - j] + if norm != 0: + PmM[j, :] = PmM[j, :] / norm + e[j] = e[j] / norm + # end + # end + fx = 0.0 + if (max(abs(e)) > 1e-6 and + max(abs(NN)) > 1e-6 * max(MA[0], mA[0])): + PMm = AA1.copy() + for j in range(nA): + norm = MA[j] + if norm != 0: + PMm[j, :] = PMm[j, :] / norm + # end + # end + PMm = np.fliplr(PMm) + + A = PMm + B = PmM + + if nA == 1: + fx = NN * (A / (1 - B * A) * e) + else: + rh = np.eye(A.shape[0]) - np.dot(B, A) + fx = np.dot( + NN, + np.dot( + A, + linalg.solve( + rh, + e))) # least squares + # end + # end + f_rfc[N - 1 - k, k - i] = fx + DRFC + + # check2=[ DRFC fx] + # pause + else: + f_rfc[N - 1 - k, k - i] = 0.0 + # end + # end + m0 = max(0, f_min[0] - np.sum(f_rfc[N - k + 1:N, 0])) + M0 = max(0, f_max[N - 1 - k] - np.sum(f_rfc[N - 1 - k, 1:k])) + f_rfc[N - 1 - k, 0] = min(m0, M0) + # n_loops_left=N-k+1 + # end + + for k in range(1, N): + M0 = max(0, f_max[0] - np.sum(f_rfc[0, N - k:N])) + m0 = max(0, f_min[N - 1 - k] - np.sum(f_rfc[1:k + 1, N - 1 - k])) + f_rfc[0, N - 1 - k] = min(m0, M0) + # end + +# %clf +# %subplot(1,2,2) +# %pcolor(levels(paramm),levels(paramM),flipud(f_mM)) +# % title('Markov matrix') +# % ylabel('max'), xlabel('min') +# %axis([paramm(1) paramm(2) paramM(1) paramM(2)]) +# %axis('square') +# +# %subplot(1,2,1) +# %pcolor(levels(paramm),levels(paramM),flipud(f_rfc)) +# % title('Rainflow matrix') +# % ylabel('max'), xlabel('rfc-min') +# %axis([paramm(1) paramm(2) paramM(1) paramM(2)]) +# %axis('square') + + return f_rfc + + +def rfcfilter(x, h, method=0): + """ + Rainflow filter a signal. + + Parameters + ----------- + x : vector + Signal. [nx1] + h : real, scalar + Threshold for rainflow filter. + method : scalar, integer + 0 : removes cycles with range < h. (default) + 1 : removes cycles with range <= h. + + Returns + -------- + y = Rainflow filtered signal. + + Examples: + --------- + # 1. Filtered signal y is the turning points of x. + >>> import utilities.data + >>> import utilities.numpy_utils as wm + >>> x = utilities.data.sea() + >>> y = wm.rfcfilter(x[:,1], h=0, method=1) + >>> np.all(np.abs(y[0:5]-np.array([-1.2004945 , 0.83950546, -0.09049454, + ... -0.02049454, -0.09049454]))<1e-7) + True + + # 2. This removes all rainflow cycles with range less than 0.5. + >>> y1 = wm.rfcfilter(x[:,1], h=0.5) + >>> np.all(np.abs(y1[0:5]-np.array([-1.2004945 , 0.83950546, -0.43049454, + ... 0.34950546, -0.51049454]))<1e-7) + True + + See also + -------- + findrfc + """ + # TODO merge rfcfilter and findrfc + y = atleast_1d(x).ravel() + n = len(y) + t = zeros(n, dtype=np.int) + j = 0 + t0 = 0 + y0 = y[t0] + + z0 = 0 + if method == 0: + cmpfun1 = lambda a, b: a <= b + cmpfun2 = lambda a, b: a < b + else: + cmpfun1 = lambda a, b: a < b + cmpfun2 = lambda a, b: a <= b + + # The rainflow filter + for tim1, yi in enumerate(y[1::]): + fpi = y0 + h + fmi = y0 - h + ti = tim1 + 1 + #yi = y[ti] + + if z0 == 0: + if cmpfun1(yi, fmi): + z1 = -1 + elif cmpfun1(fpi, yi): + z1 = +1 + else: + z1 = 0 + t1, y1 = (t0, y0) if z1 == 0 else (ti, yi) + else: + if (((z0 == +1) & cmpfun1(yi, fmi)) | + ((z0 == -1) & cmpfun2(yi, fpi))): + z1 = -1 + elif (((z0 == +1) & cmpfun2(fmi, yi)) | + ((z0 == -1) & cmpfun1(fpi, yi))): + z1 = +1 + else: + warnings.warn('Something wrong, i=%d' % tim1) + + # Update y1 + if z1 != z0: + t1, y1 = ti, yi + elif z1 == -1: + # y1 = min([y0 xi]) + t1, y1 = (t0, y0) if y0 < yi else (ti, yi) + elif z1 == +1: + # y1 = max([y0 xi]) + t1, y1 = (t0, y0) if y0 > yi else (ti, yi) + + # Update y if y0 is a turning point + if abs(z0 - z1) == 2: + j += 1 + t[j] = t0 + + # Update t0, y0, z0 + t0, y0, z0 = t1, y1, z1 + # end + + #% Update y if last y0 is greater than (or equal) threshold + if cmpfun1(h, abs(y0 - y[t[j]])): + j += 1 + t[j] = t0 + return y[t[:j + 1]] + + +def findtp(x, h=0.0, kind=None): + ''' + Return indices to turning points (tp) of data, optionally rainflowfiltered. + + Parameters + ---------- + x : vector + signal + h : real, scalar + rainflow threshold + if h<0, then ind = range(len(x)) + if h=0, then tp is a sequence of turning points (default) + if h>0, then all rainflow cycles with height smaller than + h are removed. + kind : string + defines the type of wave or indicate the ASTM rainflow counting method. + Possible options are 'astm' 'mw' 'Mw' or 'none'. + If None all rainflow filtered min and max + will be returned, otherwise only the rainflow filtered + min and max, which define a wave according to the + wave definition, will be returned. + + Returns + ------- + ind : arraylike + indices to the turning points in the original sequence. + + Example: + -------- + >>> import pylab as plt + >>> import utilities.numpy_utils as wm + >>> t = np.linspace(0,30,500).reshape((-1,1)) + >>> x = np.hstack((t, np.cos(t))) + >>> x1 = x[0:200,:] + >>> itp = wm.findtp(x1[:,1],0,'Mw') + >>> itph = wm.findtp(x1[:,1],0.3,'Mw') + >>> tp = x1[itp,:] + >>> tph = x1[itph,:] + >>> a = plt.plot(x1[:,0],x1[:,1],tp[:,0],tp[:,1],'ro', + ... tph[:,1],tph[:,1],'k.') + >>> plt.close('all') + >>> itp + array([105, 157, 199]) + >>> itph + array([105]) + + See also + --------- + findtc + findcross + findextrema + findrfc + ''' + n = len(x) + if h < 0.0: + return arange(n) + + ind = findextrema(x) + + if ind.size < 2: + return None + + # In order to get the exact up-crossing intensity from rfc by + # mm2lc(tp2mm(rfc)) we have to add the indices + # to the last value (and also the first if the + # sequence of turning points does not start with a minimum). + + if kind == 'astm': + # the Nieslony approach always put the first loading point as the first + # turning point. + # add the first turning point is the first of the signal + if x[ind[0]] != x[0]: + ind = np.r_[0, ind, n - 1] + else: # only add the last point of the signal + ind = np.r_[ind, n - 1] + else: + if x[ind[0]] > x[ind[1]]: # adds indices to first and last value + ind = r_[0, ind, n - 1] + else: # adds index to the last value + ind = r_[ind, n - 1] + + if h > 0.0: + ind1 = findrfc(x[ind], h) + ind = ind[ind1] + + if kind in ('mw', 'Mw'): + xor = lambda a, b: a ^ b + # make sure that the first is a Max if wdef == 'Mw' + # or make sure that the first is a min if wdef == 'mw' + first_is_max = (x[ind[0]] > x[ind[1]]) + + remove_first = xor(first_is_max, kind.startswith('Mw')) + if remove_first: + ind = ind[1::] + + # make sure the number of minima and Maxima are according to the + # wavedef. i.e., make sure Nm=length(ind) is odd + if (mod(ind.size, 2)) != 1: + ind = ind[:-1] + return ind + + +def findtc(x_in, v=None, kind=None): + """ + Return indices to troughs and crests of data. + + Parameters + ---------- + x : vector + surface elevation. + v : real scalar + reference level (default v = mean of x). + + kind : string + defines the type of wave. Possible options are + 'dw', 'uw', 'tw', 'cw' or None. + If None indices to all troughs and crests will be returned, + otherwise only the paired ones will be returned + according to the wavedefinition. + + Returns + -------- + tc_ind : vector of ints + indices to the trough and crest turningpoints of sequence x. + v_ind : vector of ints + indices to the level v crossings of the original + sequence x. (d,u) + + Example: + -------- + >>> import pylab as plt + >>> import utilities.numpy_utils as wm + >>> t = np.linspace(0,30,500).reshape((-1,1)) + >>> x = np.hstack((t, np.cos(t))) + >>> x1 = x[0:200,:] + >>> itc, iv = wm.findtc(x1[:,1],0,'dw') + >>> tc = x1[itc,:] + >>> a = plt.plot(x1[:,0],x1[:,1],tc[:,0],tc[:,1],'ro') + >>> plt.close('all') + + See also + -------- + findtp + findcross, + wavedef + """ + + x = atleast_1d(x_in) + if v is None: + v = x.mean() + + v_ind = findcross(x, v, kind) + n_c = v_ind.size + if n_c <= 2: + warnings.warn('There are no waves!') + return zeros(0, dtype=np.int), zeros(0, dtype=np.int) + + # determine the number of trough2crest (or crest2trough) cycles + isodd = mod(n_c, 2) + if isodd: + n_tc = int((n_c - 1) / 2) + else: + n_tc = int((n_c - 2) / 2) + + # allocate variables before the loop increases the speed + ind = zeros(n_c - 1, dtype=np.int) + + first_is_down_crossing = (x[v_ind[0]] > x[v_ind[0] + 1]) + if first_is_down_crossing: + for i in xrange(n_tc): + # trough + j = 2 * i + ind[j] = x[v_ind[j] + 1:v_ind[j + 1] + 1].argmin() + # crest + ind[j + 1] = x[v_ind[j + 1] + 1:v_ind[j + 2] + 1].argmax() + + if (2 * n_tc + 1 < n_c) and (kind in (None, 'tw')): + # trough + ind[n_c - 2] = x[v_ind[n_c - 2] + 1:v_ind[n_c - 1]].argmin() + + else: # %%%% the first is a up-crossing + for i in xrange(n_tc): + # trough + j = 2 * i + ind[j] = x[v_ind[j] + 1:v_ind[j + 1] + 1].argmax() + # crest + ind[j + 1] = x[v_ind[j + 1] + 1:v_ind[j + 2] + 1].argmin() + + if (2 * n_tc + 1 < n_c) and (kind in (None, 'cw')): + # trough + ind[n_c - 2] = x[v_ind[n_c - 2] + 1:v_ind[n_c - 1]].argmax() + + return v_ind[:n_c - 1] + ind + 1, v_ind + + +def findoutliers(x, zcrit=0.0, dcrit=None, ddcrit=None, verbose=False): + """ + Return indices to spurious points of data + + Parameters + ---------- + x : vector + of data values. + zcrit : real scalar + critical distance between consecutive points. + dcrit : real scalar + critical distance of Dx used for determination of spurious + points. (Default 1.5 standard deviation of x) + ddcrit : real scalar + critical distance of DDx used for determination of spurious + points. (Default 1.5 standard deviation of x) + + Returns + ------- + inds : ndarray of integers + indices to spurious points. + indg : ndarray of integers + indices to the rest of the points. + + Notes + ----- + Consecutive points less than zcrit apart are considered as spurious. + The point immediately after and before are also removed. Jumps greater than + dcrit in Dxn and greater than ddcrit in D^2xn are also considered as + spurious. + (All distances to be interpreted in the vertical direction.) + Another good choice for dcrit and ddcrit are: + + dcrit = 5*dT and ddcrit = 9.81/2*dT**2 + + where dT is the timestep between points. + + Examples + -------- + >>> import numpy as np + >>> import utilities.numpy_utils as wm + >>> t = np.linspace(0,30,500).reshape((-1,1)) + >>> xx = np.hstack((t, np.cos(t))) + >>> dt = np.diff(xx[:2,0]) + >>> dcrit = 5*dt + >>> ddcrit = 9.81/2*dt*dt + >>> zcrit = 0 + >>> [inds, indg] = wm.findoutliers(xx[:,1],zcrit,dcrit,ddcrit,verbose=True) + Found 0 spurious positive jumps of Dx + Found 0 spurious negative jumps of Dx + Found 0 spurious positive jumps of D^2x + Found 0 spurious negative jumps of D^2x + Found 0 consecutive equal values + Found the total of 0 spurious points + + + #waveplot(xx,'-',xx(inds,:),1,1,1) + + See also + -------- + waveplot, reconstruct + """ + + # finding outliers + findjumpsDx = True # find jumps in Dx + # two point spikes and Spikes dcrit above/under the + # previous and the following point are spurios. + findSpikes = False # find spikes + findDspikes = False # find double (two point) spikes + findjumpsD2x = True # find jumps in D^2x + findNaN = True # % find missing values + + xn = asarray(x).flatten() + + if xn.size < 2: + raise ValueError('The vector must have more than 2 elements!') + + ind = zeros(0, dtype=int) + # indg=[] + indmiss = isnan(xn) + if findNaN and indmiss.any(): + ind, = nonzero(indmiss) + if verbose: + print('Found %d missing points' % ind.size) + xn[indmiss] = 0. # %set NaN's to zero + + if dcrit is None: + dcrit = 1.5 * xn.std() + if verbose: + print('dcrit is set to %g' % dcrit) + + if ddcrit is None: + ddcrit = 1.5 * xn.std() + if verbose: + print('ddcrit is set to %g' % ddcrit) + + dxn = diff(xn) + ddxn = diff(dxn) + + if findSpikes: # finding spurious spikes + tmp, = nonzero((dxn[:-1] > dcrit) * (dxn[1::] < -dcrit) | + (dxn[:-1] < -dcrit) * (dxn[1::] > dcrit)) + if tmp.size > 0: + tmp = tmp + 1 + ind = hstack((ind, tmp)) + if verbose: + print('Found %d spurious spikes' % tmp.size) + + if findDspikes: # ,% finding spurious double (two point) spikes + tmp, = nonzero((dxn[:-2] > dcrit) * (dxn[2::] < -dcrit) | + (dxn[:-2] < -dcrit) * (dxn[2::] > dcrit)) + if tmp.size > 0: + tmp = tmp + 1 + ind = hstack((ind, tmp, tmp + 1)) # %removing both points + if verbose: + print('Found %d spurious two point (double) spikes' % tmp.size) + + if findjumpsDx: # ,% finding spurious jumps in Dx + tmp, = nonzero(dxn > dcrit) + if verbose: + print('Found %d spurious positive jumps of Dx' % tmp.size) + if tmp.size > 0: + ind = hstack((ind, tmp + 1)) # removing the point after the jump + + tmp, = nonzero(dxn < -dcrit) + if verbose: + print('Found %d spurious negative jumps of Dx' % tmp.size) + if tmp.size > 0: + ind = hstack((ind, tmp)) # removing the point before the jump + + if findjumpsD2x: # ,% finding spurious jumps in D^2x + tmp, = nonzero(ddxn > ddcrit) + if tmp.size > 0: + tmp = tmp + 1 + ind = hstack((ind, tmp)) # removing the jump + + if verbose: + print('Found %d spurious positive jumps of D^2x' % tmp.size) + + tmp, = nonzero(ddxn < -ddcrit) + if tmp.size > 0: + tmp = tmp + 1 + ind = hstack((ind, tmp)) # removing the jump + + if verbose: + print('Found %d spurious negative jumps of D^2x' % tmp.size) + + if zcrit >= 0.0: + # finding consecutive values less than zcrit apart. + indzeros = (abs(dxn) <= zcrit) + indz, = nonzero(indzeros) + if indz.size > 0: + indz = indz + 1 + # finding the beginning and end of consecutive equal values + indtr, = nonzero((diff(indzeros))) + indtr = indtr + 1 + # indices to consecutive equal points + # removing the point before + all equal points + the point after + if True: + ind = hstack((ind, indtr - 1, indz, indtr, indtr + 1)) + else: # % removing all points + the point after + ind = hstack((ind, indz, indtr, indtr + 1)) + + if verbose: + if zcrit == 0.: + print('Found %d consecutive equal values' % indz.size) + else: + print( + 'Found %d consecutive values less than %g apart.' % + (indz.size, zcrit)) + indg = ones(xn.size, dtype=bool) + + if ind.size > 1: + ind = unique(ind) + indg[ind] = 0 + indg, = nonzero(indg) + + if verbose: + print('Found the total of %d spurious points' % ind.size) + + return ind, indg + + +def common_shape(*args, ** kwds): + ''' + Return the common shape of a sequence of arrays + + Parameters + ----------- + *args : arraylike + sequence of arrays + **kwds : + shape + + Returns + ------- + shape : tuple + common shape of the elements of args. + + Raises + ------ + An error is raised if some of the arrays do not conform + to the common shape according to the broadcasting rules in numpy. + + Examples + -------- + >>> import numpy as np + >>> import utilities.numpy_utils as wm + >>> A = np.ones((4,1)) + >>> B = 2 + >>> C = np.ones((1,5))*5 + >>> wm.common_shape(A,B,C) + (4, 5) + >>> wm.common_shape(A,B,C,shape=(3,4,1)) + (3, 4, 5) + + See also + -------- + broadcast, broadcast_arrays + ''' + args = map(asarray, args) + shapes = [x.shape for x in args] + shape = kwds.get('shape') + if shape is not None: + if not isinstance(shape, (list, tuple)): + shape = (shape,) + shapes.append(tuple(shape)) + if len(set(shapes)) == 1: + # Common case where nothing needs to be broadcasted. + return tuple(shapes[0]) + shapes = [list(s) for s in shapes] + nds = [len(s) for s in shapes] + biggest = max(nds) + # Go through each array and prepend dimensions of length 1 to each of the + # shapes in order to make the number of dimensions equal. + for i in range(len(shapes)): + diff = biggest - nds[i] + if diff > 0: + shapes[i] = [1] * diff + shapes[i] + + # Check each dimension for compatibility. A dimension length of 1 is + # accepted as compatible with any other length. + c_shape = [] + for axis in range(biggest): + lengths = [s[axis] for s in shapes] + unique = set(lengths + [1]) + if len(unique) > 2: + # There must be at least two non-1 lengths for this axis. + raise ValueError("shape mismatch: two or more arrays have " + "incompatible dimensions on axis %r." % (axis,)) + elif len(unique) == 2: + # There is exactly one non-1 length. + # The common shape will take this value. + unique.remove(1) + new_length = unique.pop() + c_shape.append(new_length) + else: + # Every array has a length of 1 on this axis. Strides can be left + # alone as nothing is broadcasted. + c_shape.append(1) + + return tuple(c_shape) + + +def argsreduce(condition, * args): + """ Return the elements of each input array that satisfy some condition. + + Parameters + ---------- + condition : array_like + An array whose nonzero or True entries indicate the elements of each + input array to extract. The shape of 'condition' must match the common + shape of the input arrays according to the broadcasting rules in numpy. + arg1, arg2, arg3, ... : array_like + one or more input arrays. + + Returns + ------- + narg1, narg2, narg3, ... : ndarray + sequence of extracted copies of the input arrays converted to the same + size as the nonzero values of condition. + + Example + ------- + >>> import utilities.numpy_utils as wm + >>> import numpy as np + >>> rand = np.random.random_sample + >>> A = rand((4,5)) + >>> B = 2 + >>> C = rand((1,5)) + >>> cond = np.ones(A.shape) + >>> [A1,B1,C1] = wm.argsreduce(cond,A,B,C) + >>> B1.shape + (20,) + >>> cond[2,:] = 0 + >>> [A2,B2,C2] = wm.argsreduce(cond,A,B,C) + >>> B2.shape + (15,) + + See also + -------- + numpy.extract + """ + newargs = atleast_1d(*args) + if not isinstance(newargs, list): + newargs = [newargs, ] + expand_arr = (condition == condition) + return [extract(condition, arr1 * expand_arr) for arr1 in newargs] + + +def stirlerr(n): + ''' + Return error of Stirling approximation, + i.e., log(n!) - log( sqrt(2*pi*n)*(n/exp(1))**n ) + + Example + ------- + >>> import utilities.numpy_utils as wm + >>> np.abs(wm.stirlerr(2)-array([ 0.0413407]))<1e-7 + array([ True], dtype=bool) + + See also + --------- + binom + + + Reference + ----------- + Catherine Loader (2000). + Fast and Accurate Computation of Binomial Probabilities + + + ''' + + S0 = 0.083333333333333333333 # /* 1/12 */ + S1 = 0.00277777777777777777778 # /* 1/360 */ + S2 = 0.00079365079365079365079365 # /* 1/1260 */ + S3 = 0.000595238095238095238095238 # /* 1/1680 */ + S4 = 0.0008417508417508417508417508 # /* 1/1188 */ + + n1 = atleast_1d(n) + + y = gammaln(n1 + 1) - log(sqrt(2 * pi * n1) * (n1 / exp(1)) ** n1) + + nn = n1 * n1 + + n500 = 500 < n1 + y[n500] = (S0 - S1 / nn[n500]) / n1[n500] + n80 = logical_and(80 < n1, n1 <= 500) + if any(n80): + y[n80] = (S0 - (S1 - S2 / nn[n80]) / nn[n80]) / n1[n80] + n35 = logical_and(35 < n1, n1 <= 80) + if any(n35): + nn35 = nn[n35] + y[n35] = (S0 - (S1 - (S2 - S3 / nn35) / nn35) / nn35) / n1[n35] + + n15 = logical_and(15 < n1, n1 <= 35) + if any(n15): + nn15 = nn[n15] + y[n15] = ( + S0 - (S1 - (S2 - (S3 - S4 / nn15) / nn15) / nn15) / nn15) / n1[n15] + + return y + + +def binomln(z, w): + ''' + Natural Logarithm of binomial coefficient. + + CALL binomln(z,w) + + BINOMLN computes the natural logarithm of the binomial + function for corresponding elements of Z and W. The arrays Z and + W must be real and nonnegative. Both arrays must be the same size, + or either can be scalar. BETALOGE is defined as: + + y = LOG(binom(Z,W)) = gammaln(Z)-gammaln(W)-gammaln(Z-W) + + and is obtained without computing BINOM(Z,W). Since the binom + function can range over very large or very small values, its + logarithm is sometimes more useful. + This implementation is more accurate than the log(BINOM(Z,W) implementation + for large arguments + + Example + ------- + + >>> abs(binomln(3,2)- 1.09861229)<1e-7 + array([ True], dtype=bool) + + See also + -------- + binom + ''' + # log(n!) = stirlerr(n) + log( sqrt(2*pi*n)*(n/exp(1))**n ) + # y = gammaln(z+1)-gammaln(w+1)-gammaln(z-w+1) + zpw = z - w + return (stirlerr(z + 1) - stirlerr(w + 1) - 0.5 * log(2 * pi) + - (w + 0.5) * log1p(w) + (z + 0.5) * log1p(z) - stirlerr(zpw + 1) + - (zpw + 0.5) * log1p(zpw) + 1) + + +def betaloge(z, w): + ''' + Natural Logarithm of beta function. + + CALL betaloge(z,w) + + BETALOGE computes the natural logarithm of the beta + function for corresponding elements of Z and W. The arrays Z and + W must be real and nonnegative. Both arrays must be the same size, + or either can be scalar. BETALOGE is defined as: + + y = LOG(BETA(Z,W)) = gammaln(Z)+gammaln(W)-gammaln(Z+W) + + and is obtained without computing BETA(Z,W). Since the beta + function can range over very large or very small values, its + logarithm is sometimes more useful. + This implementation is more accurate than the BETALN implementation + for large arguments + + Example + ------- + >>> import utilities.numpy_utils as wm + >>> abs(wm.betaloge(3,2)+2.48490665)<1e-7 + array([ True], dtype=bool) + + See also + -------- + betaln, beta + ''' + # y = gammaln(z)+gammaln(w)-gammaln(z+w) + zpw = z + w + return (stirlerr(z) + stirlerr(w) + 0.5 * log(2 * pi) + (w - 0.5) * log(w) + + (z - 0.5) * log(z) - stirlerr(zpw) - (zpw - 0.5) * log(zpw)) + + # stirlings approximation: + # (-(zpw-0.5).*log(zpw) +(w-0.5).*log(w)+(z-0.5).*log(z) +0.5*log(2*pi)) + # return y + + +def gravity(phi=45): + ''' Returns the constant acceleration of gravity + + GRAVITY calculates the acceleration of gravity + using the international gravitational formulae [1]_: + + g = 9.78049*(1+0.0052884*sin(phir)**2-0.0000059*sin(2*phir)**2) + where + phir = phi*pi/180 + + Parameters + ---------- + phi : {float, int} + latitude in degrees + + Returns + -------- + g : ndarray + acceleration of gravity [m/s**2] + + Examples + -------- + >>> import utilities.numpy_utils as wm + >>> import numpy as np + >>> phi = np.linspace(0,45,5) + >>> np.abs(wm.gravity(phi)-array([ 9.78049 , 9.78245014, 9.78803583, + ... 9.79640552, 9.80629387]))<1.e-7 + array([ True, True, True, True, True], dtype=bool) + + See also + -------- + wdensity + + References + ---------- + .. [1] Irgens, Fridtjov (1987) + "Formelsamling i mekanikk: + statikk, fasthetsl?re, dynamikk fluidmekanikk" + tapir forlag, University of Trondheim, + ISBN 82-519-0786-1, pp 19 + + ''' + + phir = phi * pi / 180. # change from degrees to radians + return 9.78049 * \ + (1. + 0.0052884 * sin(phir) ** 2. - 0.0000059 * sin(2 * phir) ** 2.) + + +def nextpow2(x): + ''' + Return next higher power of 2 + + Example + ------- + >>> import utilities.numpy_utils as wm + >>> wm.nextpow2(10) + 4 + >>> wm.nextpow2(np.arange(5)) + 3 + ''' + t = isscalar(x) or len(x) + if (t > 1): + f, n = frexp(t) + else: + f, n = frexp(abs(x)) + + if (f == 0.5): + n = n - 1 + return n + + +def discretize(fun, a, b, tol=0.005, n=5, method='linear'): + ''' + Automatic discretization of function + + Parameters + ---------- + fun : callable + function to discretize + a,b : real scalars + evaluation limits + tol : real, scalar + absoute error tolerance + n : scalar integer + number of values + method : string + defining method of gridding, options are 'linear' and 'adaptive' + + Returns + ------- + x : discretized values + y : fun(x) + + Example + ------- + >>> import utilities.numpy_utils as wm + >>> import numpy as np + >>> import pylab as plt + >>> x,y = wm.discretize(np.cos, 0, np.pi) + >>> xa,ya = wm.discretize(np.cos, 0, np.pi, method='adaptive') + >>> t = plt.plot(x, y, xa, ya, 'r.') + + plt.show() + >>> plt.close('all') + + ''' + if method.startswith('a'): + return _discretize_adaptive(fun, a, b, tol, n) + else: + return _discretize_linear(fun, a, b, tol, n) + + +def _discretize_linear(fun, a, b, tol=0.005, n=5): + ''' + Automatic discretization of function, linear gridding + ''' + tiny = floatinfo.tiny + + x = linspace(a, b, n) + y = fun(x) + + err0 = inf + err = 10000 + nmax = 2 ** 20 + while (err != err0 and err > tol and n < nmax): + err0 = err + x0 = x + y0 = y + n = 2 * (n - 1) + 1 + x = linspace(a, b, n) + y = fun(x) + y00 = interp(x, x0, y0) + err = 0.5 * amax(abs((y00 - y) / (abs(y00 + y) + tiny))) + return x, y + + +def _discretize_adaptive(fun, a, b, tol=0.005, n=5): + ''' + Automatic discretization of function, adaptive gridding. + ''' + tiny = floatinfo.tiny + n += (mod(n, 2) == 0) # make sure n is odd + x = linspace(a, b, n) + fx = fun(x) + + n2 = (n - 1) / 2 + erri = hstack((zeros((n2, 1)), ones((n2, 1)))).ravel() + err = erri.max() + err0 = inf + # while (err != err0 and err > tol and n < nmax): + for j in range(50): + if err != err0 and np.any(erri > tol): + err0 = err + # find top errors + + I, = where(erri > tol) + # double the sample rate in intervals with the most error + y = (vstack(((x[I] + x[I - 1]) / 2, + (x[I + 1] + x[I]) / 2)).T).ravel() + fy = fun(y) + + fy0 = interp(y, x, fx) + erri = 0.5 * (abs((fy0 - fy) / (abs(fy0 + fy) + tiny))) + + err = erri.max() + + x = hstack((x, y)) + + I = x.argsort() + x = x[I] + erri = hstack((zeros(len(fx)), erri))[I] + fx = hstack((fx, fy))[I] + + else: + break + else: + warnings.warn('Recursion level limit reached j=%d' % j) + + return x, fx + + +def polar2cart(theta, rho, z=None): + ''' + Transform polar coordinates into 2D cartesian coordinates. + + Returns + ------- + x, y : array-like + Cartesian coordinates, x = rho*cos(theta), y = rho*sin(theta) + + See also + -------- + cart2polar + ''' + x, y = rho * cos(theta), rho * sin(theta) + if z is None: + return x, y + else: + return x, y, z +pol2cart = polar2cart + + +def cart2polar(x, y, z=None): + ''' Transform 2D cartesian coordinates into polar coordinates. + + Returns + ------- + theta : array-like + radial angle, arctan2(y,x) + rho : array-like + radial distance, sqrt(x**2+y**2) + + See also + -------- + polar2cart + ''' + t, r = arctan2(y, x), hypot(x, y) + if z is None: + return t, r + else: + return t, r, z + +cart2pol = cart2polar + + +def ndgrid(*args, **kwargs): + """ + Same as calling meshgrid with indexing='ij' (see meshgrid for + documentation). + """ + kwargs['indexing'] = 'ij' + return meshgrid(*args, ** kwargs) + + +def trangood(x, f, min_n=None, min_x=None, max_x=None, max_n=inf): + """ + Make sure transformation is efficient. + + Parameters + ------------ + x, f : array_like + input transform function, (x,f(x)). + min_n : scalar, int + minimum number of points in the good transform. + (Default x.shape[0]) + min_x : scalar, real + minimum x value to transform. (Default min(x)) + max_x : scalar, real + maximum x value to transform. (Default max(x)) + max_n : scalar, int + maximum number of points in the good transform + (default inf) + Returns + ------- + x, f : array_like + the good transform function. + + TRANGOOD interpolates f linearly and optionally + extrapolate it linearly outside the range of x + with X uniformly spaced. + + See also + --------- + tranproc, + numpy.interp + """ + xo, fo = atleast_1d(x, f) + # n = xo.size + if (xo.ndim != 1): + raise ValueError('x must be a vector.') + if (fo.ndim != 1): + raise ValueError('f must be a vector.') + + i = xo.argsort() + xo = xo[i] + fo = fo[i] + del i + dx = diff(xo) + if (any(dx <= 0)): + raise ValueError('Duplicate x-values not allowed.') + + nf = fo.shape[0] + + if max_x is None: + max_x = xo[-1] + if min_x is None: + min_x = xo[0] + if min_n is None: + min_n = nf + if (min_n < 2): + min_n = 2 + if (max_n < 2): + max_n = 2 + + ddx = diff(dx) + xn = xo[-1] + x0 = xo[0] + L = float(xn - x0) + eps = floatinfo.eps + if ((nf < min_n) or (max_n < nf) or any(abs(ddx) > 10 * eps * (L))): + # pab 07.01.2001: Always choose the stepsize df so that + # it is an exactly representable number. + # This is important when calculating numerical derivatives and is + # accomplished by the following. + dx = L / (min(min_n, max_n) - 1) + dx = (dx + 2.) - 2. + xi = arange(x0, xn + dx / 2., dx) + # New call pab 11.11.2000: This is much quicker + fo = interp(xi, xo, fo) + xo = xi + +# x is now uniformly spaced + dx = xo[1] - xo[0] + + # Extrapolate linearly outside the range of ff + if (min_x < xo[0]): + x1 = dx * arange(floor((min_x - xo[0]) / dx), -2) + f2 = fo[0] + x1 * (fo[1] - fo[0]) / (xo[1] - xo[0]) + fo = hstack((f2, fo)) + xo = hstack((x1 + xo[0], xo)) + + if (max_x > xo[-1]): + x1 = dx * arange(1, ceil((max_x - xo[-1]) / dx) + 1) + f2 = f[-1] + x1 * (f[-1] - f[-2]) / (xo[-1] - xo[-2]) + fo = hstack((fo, f2)) + xo = hstack((xo, x1 + xo[-1])) + + return xo, fo + + +def tranproc(x, f, x0, *xi): + """ + Transforms process X and up to four derivatives + using the transformation f. + + Parameters + ---------- + x,f : array-like + [x,f(x)], transform function, y = f(x). + x0, x1,...,xn : vectors + where xi is the i'th time derivative of x0. 0<=N<=4. + + Returns + ------- + y0, y1,...,yn : vectors + where yi is the i'th time derivative of y0 = f(x0). + + By the basic rules of derivation: + Y1 = f'(X0)*X1 + Y2 = f''(X0)*X1^2 + f'(X0)*X2 + Y3 = f'''(X0)*X1^3 + f'(X0)*X3 + 3*f''(X0)*X1*X2 + Y4 = f''''(X0)*X1^4 + f'(X0)*X4 + 6*f'''(X0)*X1^2*X2 + + f''(X0)*(3*X2^2 + 4*X1*X3) + + The derivation of f is performed numerically with a central difference + method with linear extrapolation towards the beginning and end of f, + respectively. + + Example + -------- + Derivative of g and the transformed Gaussian model. + import pylab as plt + import utilities.numpy_utils as wm + import utilities.transform.models as wtm + tr = wtm.TrHermite() + x = linspace(-5,5,501) + g = tr(x) + gder = wm.tranproc(x, g, x, ones(g.shape[0])) + h = plt.plot(x, g, x, gder[1]) + + plt.plot(x,pdfnorm(g)*gder[1],x,pdfnorm(x)) + plt.legend('Transformed model','Gaussian model') + + plt.close('all') + + See also + -------- + trangood. + """ + + eps = floatinfo.eps + xo, fo, x0 = atleast_1d(x, f, x0) + xi = atleast_1d(*xi) + if not isinstance(xi, list): + xi = [xi, ] + N = len(xi) # N = number of derivatives + nmax = ceil((xo.ptp()) * 10 ** (7. / max(N, 1))) + xo, fo = trangood(xo, fo, min_x=min(x0), max_x=max(x0), max_n=nmax) + + n = f.shape[0] + # y = x0.copy() + xu = (n - 1) * (x0 - xo[0]) / (xo[-1] - xo[0]) + + fi = asarray(floor(xu), dtype=int) + fi = where(fi == n - 1, fi - 1, fi) + + xu = xu - fi + y0 = fo[fi] + (fo[fi + 1] - fo[fi]) * xu + + y = y0 + + if N > 0: + y = [y0] + hn = xo[1] - xo[0] + if hn ** N < sqrt(eps): + warnings.warn('Numerical problems may occur for the derivatives' + + ' in tranproc. The sampling of the transformation' + + ' may be too small.') + + # Transform X with the derivatives of f. + fxder = zeros((N, x0.size)) + fder = vstack((xo, fo)) + for k in range(N): # Derivation of f(x) using a difference method. + n = fder.shape[-1] + fder = vstack([(fder[0, 0:n - 1] + fder[0, 1:n]) / 2, + diff(fder[1, :]) / hn]) + fxder[k] = tranproc(fder[0], fder[1], x0) + + # Calculate the transforms of the derivatives of X. + # First time derivative of y: y1 = f'(x)*x1 + + y1 = fxder[0] * xi[0] + y.append(y1) + if N > 1: + + # Second time derivative of y: + # y2 = f''(x)*x1.^2+f'(x)*x2 + y2 = fxder[1] * xi[0] ** 2. + fxder[0] * xi[1] + y.append(y2) + if N > 2: + # Third time derivative of y: + # y3 = f'''(x)*x1.^3+f'(x)*x3 +3*f''(x)*x1*x2 + y3 = fxder[2] * xi[0] ** 3 + fxder[0] * xi[2] + \ + 3 * fxder[1] * xi[0] * xi[1] + y.append(y3) + if N > 3: + # Fourth time derivative of y: + # y4 = f''''(x)*x1.^4+f'(x)*x4 + # +6*f'''(x)*x1^2*x2+f''(x)*(3*x2^2+4x1*x3) + y4 = (fxder[3] * xi[0] ** 4. + fxder[0] * xi[3] + + 6. * fxder[2] * xi[0] ** 2. * xi[1] + + fxder[1] * (3. * xi[1] ** 2. + 4. * xi[0] * xi[1])) + y.append(y4) + if N > 4: + warnings.warn('Transformation of derivatives of' + + ' order>4 not supported.') + return y # y0,y1,y2,y3,y4 + + +def good_bins(data=None, range=None, num_bins=None, # @ReservedAssignment + num_data=None, odd=False, loose=True): + ''' Return good bins for histogram + + Parameters + ---------- + data : array-like + the data + range : (float, float), (default data.min(), data.max()) + minimum and maximum range of bins + num_bins : scalar integer, (default depending on num_data=len(data)) + approximate number of bins wanted + odd : bool + placement of bins (0 or 1) (default 0) + loose : bool + if True add extra space to min and max + if False the bins are made tight to the min and max + + Example + ------- + >>> import utilities.numpy_utils as wm + >>> wm.good_bins(range=(0,5), num_bins=6) + array([-1., 0., 1., 2., 3., 4., 5., 6.]) + >>> wm.good_bins(range=(0,5), num_bins=6, loose=False) + array([ 0., 1., 2., 3., 4., 5.]) + >>> wm.good_bins(range=(0,5), num_bins=6, odd=True) + array([-1.5, -0.5, 0.5, 1.5, 2.5, 3.5, 4.5, 5.5, 6.5]) + >>> wm.good_bins(range=(0,5), num_bins=6, odd=True, loose=False) + array([-0.5, 0.5, 1.5, 2.5, 3.5, 4.5, 5.5]) + ''' + + if data is not None: + x = np.atleast_1d(data) + num_data = len(x) + + mn, mx = range if range else (x.min(), x.max()) + + if num_bins is None: + num_bins = np.ceil(4 * np.sqrt(np.sqrt(num_data))) + + d = float(mx - mn) / num_bins * 2 + e = np.floor(np.log(d) / np.log(10)) + m = np.floor(d / 10 ** e) + if m > 5: + m = 5 + elif m > 2: + m = 2 + + d = m * 10 ** e + mn = (np.floor(mn / d) - loose) * d - odd * d / 2 + mx = (np.ceil(mx / d) + loose) * d + odd * d / 2 + limits = np.arange(mn, mx + d / 2, d) + return limits + + +def plot_histgrm(data, bins=None, range=None, # @ReservedAssignment + normed=False, weights=None, lintype='b-'): + ''' + Plot histogram + + Parameters + ----------- + data : array-like + the data + bins : int or sequence of scalars, optional + If an int, it defines the number of equal-width + bins in the given range (4 * sqrt(sqrt(len(data)), by default). + If a sequence, it defines the bin edges, including the + rightmost edge, allowing for non-uniform bin widths. + range : (float, float), optional + The lower and upper range of the bins. If not provided, range + is simply ``(data.min(), data.max())``. Values outside the range are + ignored. + normed : bool, optional + If False, the result will contain the number of samples in each bin. + If True, the result is the value of the probability *density* function + at the bin, normalized such that the *integral* over the range is 1. + weights : array_like, optional + An array of weights, of the same shape as `data`. Each value in `data` + only contributes its associated weight towards the bin count + (instead of 1). If `normed` is True, the weights are normalized, + so that the integral of the density over the range remains 1 + lintype : specify color and lintype, see PLOT for possibilities. + + Returns + ------- + h : list + of plot-objects + + Example + ------- + >>> import pylab as plt + >>> import utilities.numpy_utils as wm + >>> import scipy.stats as ws + >>> R = ws.weibull_min.rvs(2,loc=0,scale=2, size=100) + + >>> h0 = wm.plot_histgrm(R, 20, normed=True) + >>> x = np.linspace(-3,16,200) + >>> h1 = plt.plot(x,ws.weibull_min.pdf(x,2,0,2),'r') + >>> plt.close('all') + + See also + -------- + utilities.numpy_utils.good_bins + numpy.histogram + ''' + from utilities.plotbackend import plotbackend # @UnresolvedImport + + x = np.atleast_1d(data) + if bins is None: + bins = np.ceil(4 * np.sqrt(np.sqrt(len(x)))) + + # , new=True) @ReservedAssignment + y, limits = np.histogram(data, bins=bins, normed=normed, weights=weights) + limits.shape = (-1, 1) + xx = limits.repeat(3, axis=1) + xx.shape = (-1,) + xx = xx[1:-1] + y.shape = (-1, 1) + yy = y.repeat(3, axis=1) + # yy[0,0] = 0.0 # pdf + yy[:, 0] = 0.0 # histogram + yy.shape = (-1,) + yy = np.hstack((yy, 0.0)) + return plotbackend.plot(xx, yy, lintype, limits, limits * 0) + + +def num2pistr(x, n=3): + ''' + Convert a scalar to a text string in fractions of pi + if the numerator is less than 10 and not equal 0 + and if the denominator is less than 10. + + Parameters + ---------- + x = a scalar + n = maximum digits of precision. (default 3) + Returns + ------- + xtxt = a text string in fractions of pi + + Example + >>> import utilities.numpy_utils as wm + >>> wm.num2pistr(np.pi*3/4)=='3\\pi/4' + True + ''' + + frac = fractions.Fraction.from_float(x / pi).limit_denominator(10000000) + num = frac.numerator + den = frac.denominator + if (den < 10) and (num < 10) and (num != 0): + dtxt = '' if abs(den) == 1 else '/%d' % den + if abs(num) == 1: # % numerator + ntxt = '-' if num == -1 else '' + else: + ntxt = '%d' % num + xtxt = ntxt + r'\pi' + dtxt + else: + format = '%0.' + '%dg' % n # @ReservedAssignment + xtxt = format % x + return xtxt + + +def fourier(data, t=None, T=None, m=None, n=None, method='trapz'): + ''' + Returns Fourier coefficients. + + Parameters + ---------- + data : array-like + vector or matrix of row vectors with data points shape p x n. + t : array-like + vector with n values indexed from 1 to N. + T : real scalar, (default T = t[-1]-t[0]) + primitive period of signal, i.e., smallest period. + m : scalar integer + defines no of harmonics desired (default M = N) + n : scalar integer + no of data points (default len(t)) + method : string + integration method used + + Returns + ------- + a,b = Fourier coefficients size m x p + + FOURIER finds the coefficients for a Fourier series representation + of the signal x(t) (given in digital form). It is assumed the signal + is periodic over T. N is the number of data points, and M-1 is the + number of coefficients. + + The signal can be estimated by using M-1 harmonics by: + M-1 + x[i] = 0.5*a[0] + sum (a[n]*c[n,i] + b[n]*s[n,i]) + n=1 + where + c[n,i] = cos(2*pi*(n-1)*t[i]/T) + s[n,i] = sin(2*pi*(n-1)*t[i]/T) + + Note that a[0] is the "dc value". + Remaining values are a[1], a[2], ... , a[M-1]. + + Example + ------- + >>> import utilities.numpy_utils as wm + >>> import numpy as np + >>> T = 2*np.pi + >>> t = np.linspace(0,4*T) + >>> x = np.sin(t) + >>> a, b = wm.fourier(x, t, T=T, m=5) + >>> (np.round(a.ravel()), np.round(b.ravel())) + (array([ 0., 0., 0., 0., 0.]), array([ 0., 4., 0., 0., 0.])) + + See also + -------- + fft + ''' + x = np.atleast_2d(data) + p, n = x.shape + if t is None: + t = np.arange(n) + else: + t = np.atleast_1d(t) + + n = len(t) if n is None else n + m = n if n is None else m + T = t[-1] - t[0] if T is None else T + + if method.startswith('trapz'): + intfun = trapz + elif method.startswith('simp'): + intfun = simps + + # Define the vectors for computing the Fourier coefficients + t.shape = (1, -1) + a = zeros((m, p)) + b = zeros((m, p)) + a[0] = intfun(x, t, axis=-1) + + # Compute M-1 more coefficients + tmp = 2 * pi * t / T + # tmp = 2*pi*(0:N-1).'/(N-1); + for i in range(1, m): + a[i] = intfun(x * cos(i * tmp), t, axis=-1) + b[i] = intfun(x * sin(i * tmp), t, axis=-1) + + a = a / pi + b = b / pi + + # Alternative: faster for large M, but gives different results than above. +# nper = diff(t([1 end]))/T; %No of periods given +# if nper == round(nper): +# N1 = n/nper +# else: +# N1 = n +# +# +# +# Fourier coefficients by fft +# Fcof1 = 2*ifft(x(1:N1,:),[],1); +# Pcor = [1; exp(sqrt(-1)*(1:M-1).'*t(1))] # correction term to get +# # the correct integration limits +# Fcof = Fcof1(1:M,:).*Pcor(:,ones(1,P)); +# a = real(Fcof(1:M,:)); +# b = imag(Fcof(1:M,:)); + + return a, b + + +def _test_find_cross(): + t = findcross([0, 0, 1, -1, 1], 0) # @UnusedVariable + + +def _test_common_shape(): + + A = ones((4, 1)) + B = 2 + C = ones((1, 5)) * 5 + common_shape(A, B, C) + + common_shape(A, B, C, shape=(3, 4, 1)) + + A = ones((4, 1)) + B = 2 + C = ones((1, 5)) * 5 + common_shape(A, B, C, shape=(4, 5)) + + +def _test_meshgrid(): + x = array([-1, -0.5, 1, 4, 5], float) + y = array([0, -2, -5], float) + xv, yv = meshgrid(x, y, sparse=False) + print(xv) + print(yv) + xv, yv = meshgrid(x, y, sparse=True) # make sparse output arrays + print(xv) + print(yv) + print(meshgrid(0, 1, 5, sparse=True)) # just a 3D point + print(meshgrid([0, 1, 5], sparse=True)) # just a 3D point + xv, yv = meshgrid(y, y) + yv[0, 0] = 10 + print(xv) + print(yv) +# >>> xv +# array([[ 0. , 0.5, 1. ]]) +# >>> yv +# array([[ 0.], +# [ 1.]]) +# array([[-1. , -0.5, 1. , 4. , 5. ], +# [-1. , -0.5, 1. , 4. , 5. ], +# [-1. , -0.5, 1. , 4. , 5. ]]) +## +# array([[ 0., 0., 0., 0., 0.], +# [-2., -2., -2., -2., -2.], +# [-5., -5., -5., -5., -5.]]) + + +def _test_tranproc(): + # import utilitiestransform.models as wtm + tr = lambda x: x # wtm.TrHermite() + x = linspace(-5, 5, 501) + g = tr(x) + _gder = tranproc(x, g, x, ones(g.size)) + pass + # >>> gder(:,1) = g(:,1) + # >>> plot(g(:,1),[g(:,2),gder(:,2)]) + # >>> plot(g(:,1),pdfnorm(g(:,2)).*gder(:,2),g(:,1),pdfnorm(g(:,1))) + # >>> legend('Transformed model','Gaussian model') + + +def _test_detrend(): + import pylab as plt + cos = np.cos + randn = np.random.randn + x = linspace(0, 1, 200) + y = exp(x) + cos(5 * 2 * pi * x) + 1e-1 * randn(x.size) + y0 = detrendma(y, 20) + tr = y - y0 + plt.plot(x, y, x, y0, 'r', x, exp(x), 'k', x, tr, 'm') + + +def _test_extrema(): + import pylab as plt + from pylab import plot + t = plt.linspace(0, 7 * pi, 250) + x = plt.sin(t) + 0.1 * sin(50 * t) + ind = findextrema(x) + ti, tp = t[ind], x[ind] + plot(t, x, '.', ti, tp, 'r.') + _ind1 = findrfc(tp, 0.3) + + +def _test_discretize(): + import pylab as plt + x, y = discretize(cos, 0, pi) + plt.plot(x, y) + plt.show() + plt.close('all') + + +def _test_stirlerr(): + x = linspace(1, 5, 6) + print stirlerr(x) + print stirlerr(1) + # print getshipchar(1000) + print betaloge(3, 2) + + +def _test_parse_kwargs(): + opt = dict(arg1=1, arg2=3) + print opt + opt = parse_kwargs(opt, arg1=5) + print opt + opt2 = dict(arg3=15) + opt = parse_kwargs(opt, **opt2) + print opt + + opt0 = testfun('default') + print opt0 + opt0.update(opt1=100) + print opt0 + opt0 = parse_kwargs(opt0, opt2=200) + print opt0 + out1 = testfun(opt0['opt1'], **opt0) + print out1 + + +def real_main0(): + x = np.arange(10000) + y = np.arange(100).reshape(-1, 1) + np.broadcast_arrays(x, y, x, x, x, x, x, x, x, x) + + +def real_main(): + x = np.arange(100000) + y = np.arange(100).reshape(-1, 1) + common_shape(x, y, x, x, x, x, x, x, x, x) + + +def profile_main1(): + # This is the main function for profiling + # We've renamed our original main() above to real_main() + import cProfile + import pstats + prof = cProfile.Profile() + prof = prof.runctx("real_main()", globals(), locals()) + print "
"
+    stats = pstats.Stats(prof)
+    stats.sort_stats("time")  # Or cumulative
+    stats.print_stats(80)  # 80 = how many to print
+    # The rest is optional.
+    # stats.print_callees()
+    # stats.print_callers()
+    print "
" + + +main = profile_main1 + + +def test_docstrings(): + # np.set_printoptions(precision=6) + import doctest + print('Testing docstrings in %s' % __file__) + doctest.testmod(optionflags=doctest.NORMALIZE_WHITESPACE) + +if __name__ == "__main__": + test_docstrings() diff --git a/pywafo/src/wafo/test/test_numpy_utils.py b/pywafo/src/wafo/test/test_numpy_utils.py new file mode 100644 index 0000000..c088c09 --- /dev/null +++ b/pywafo/src/wafo/test/test_numpy_utils.py @@ -0,0 +1,253 @@ +from numpy.testing import ( + TestCase, assert_, assert_array_equal, assert_raises,) +# run_module_suite, +# assert_allclose, assert_array_max_ulp, assert_warns, +# assert_equal, assert_array_almost_equal, assert_almost_equal, +# ) + +import unittest as local_unittest +from wafo.numpy_utils import (rotation_matrix, rotate_2d, spaceline, + args_flat, sub2index, index2sub, piecewise) +import numpy as np + + +class TestPiecewise(TestCase): + def test_condition_is_single_bool_list(self): + assert_raises(ValueError, piecewise, [0, 0], [True, False], [1]) + + def test_condition_is_list_of_single_bool_list(self): + x = piecewise([0, 0], [[True, False]], [1]) + assert_array_equal(x, [1, 0]) + + def test_conditions_is_list_of_single_bool_array(self): + x = piecewise([0, 0], [np.array([True, False])], [1]) + assert_array_equal(x, [1, 0]) + + def test_condition_is_single_int_array(self): + assert_raises(ValueError, piecewise, [0, 0], np.array([1, 0]), [1]) + + def test_condition_is_list_of_single_int_array(self): + x = piecewise([0, 0], [np.array([1, 0])], [1]) + assert_array_equal(x, [1, 0]) + + def test_simple(self): + x = piecewise([0, 0], [[False, True]], [lambda x:-1]) + assert_array_equal(x, [0, -1]) + + x = piecewise([1, 2], [[True, False], [False, True]], [3, 4]) + assert_array_equal(x, [3, 4]) + + def test_default(self): + # No value specified for x[1], should be 0 + x = piecewise([1, 2], [[True, False]], [2]) + assert_array_equal(x, [2, 0]) + + # Should set x[1] to 3 + x = piecewise([1, 2], [[True, False]], [2, 3]) + assert_array_equal(x, [2, 3]) + + def test_0d(self): + x = np.array(3) + y = piecewise(x, [x > 3], [4, 0]) + assert_(y.ndim == 0) + assert_(y == 0) + + x = 5 + y = piecewise(x, [[True], [False]], [1, 0]) + assert_(y.ndim == 0) + assert_(y == 1) + + def test_abs_function(self): + x = np.linspace(-2.5, 2.5, 6) + vals = piecewise((x,), [x < 0, x >= 0], [lambda x: -x, lambda x: x]) + assert_array_equal(vals, + [2.5, 1.5, 0.5, 0.5, 1.5, 2.5]) + + def test_abs_function_with_scalar(self): + x = np.array(-2.5) + vals = piecewise((x,), [x < 0, x >= 0], [lambda x: -x, lambda x: x]) + assert_(vals == 2.5) + + def test_otherwise_condition(self): + x = np.linspace(-2.5, 2.5, 6) + vals = piecewise((x,), [x < 0, ], [lambda x: -x, lambda x: x]) + assert_array_equal(vals, [2.5, 1.5, 0.5, 0.5, 1.5, 2.5]) + + def test_passing_further_args_to_fun(self): + def fun0(x, y, scale=1.): + return -x*y/scale + + def fun1(x, y, scale=1.): + return x*y/scale + x = np.linspace(-2.5, 2.5, 6) + vals = piecewise((x,), [x < 0, ], [fun0, fun1], args=(2.,), scale=2.) + assert_array_equal(vals, [2.5, 1.5, 0.5, 0.5, 1.5, 2.5]) + + def test_step_function(self): + x = np.linspace(-2.5, 2.5, 6) + vals = piecewise(x, [x < 0, x >= 0], [-1, 1]) + assert_array_equal(vals, [-1., -1., -1., 1., 1., 1.]) + + def test_step_function_with_scalar(self): + x = 1 + vals = piecewise(x, [x < 0, x >= 0], [-1, 1]) + assert_(vals == 1) + + def test_function_with_two_args(self): + x = np.linspace(-2, 2, 5) + X, Y = np.meshgrid(x, x) + vals = piecewise( + (X, Y), [X * Y < 0, ], [lambda x, y: -x * y, lambda x, y: x * y]) + assert_array_equal(vals, [[4., 2., -0., 2., 4.], + [2., 1., -0., 1., 2.], + [-0., -0., 0., 0., 0.], + [2., 1., 0., 1., 2.], + [4., 2., 0., 2., 4.]]) + + def test_fill_value_and_function_with_two_args(self): + x = np.linspace(-2, 2, 5) + X, Y = np.meshgrid(x, x) + vals = piecewise((X, Y), [X * Y < -0.5, X * Y > 0.5], + [lambda x, y: -x * y, lambda x, y: x * y], + fill_value=np.nan) + nan = np.nan + assert_array_equal(vals, [[4., 2., nan, 2., 4.], + [2., 1., nan, 1., 2.], + [nan, nan, nan, nan, nan], + [2., 1., nan, 1., 2.], + [4., 2., nan, 2., 4.]]) + + def test_fill_value2_and_function_with_two_args(self): + x = np.linspace(-2, 2, 5) + X, Y = np.meshgrid(x, x) + vals = piecewise((X, Y), [X * Y < -0.5, X * Y > 0.5], + [lambda x, y: -x * y, lambda x, y: x * y, np.nan]) + nan = np.nan + assert_array_equal(vals, [[4., 2., nan, 2., 4.], + [2., 1., nan, 1., 2.], + [nan, nan, nan, nan, nan], + [2., 1., nan, 1., 2.], + [4., 2., nan, 2., 4.]]) + + +class TestRotationMatrix(TestCase): + + def test_h0_p0_r0(self): + vals = rotation_matrix(heading=0, pitch=0, roll=0).tolist() + truevals = [[1., 0., 0.], + [0., 1., 0.], + [0., 0., 1.]] + self.assertListEqual(vals, truevals) + + def test_h180_p0_r0(self): + vals = rotation_matrix(heading=180, pitch=0, roll=0).tolist() + truevals = [[-1.0, -1.2246467991473532e-16, 0.0], + [1.2246467991473532e-16, -1.0, 0.0], + [-0.0, 0.0, 1.0]] + self.assertListEqual(vals, truevals) + + def test_h0_p180_r0(self): + vals = rotation_matrix(heading=0, pitch=180, roll=0).tolist() + truevals = [[-1.0, 0.0, 1.2246467991473532e-16], + [-0.0, 1.0, 0.0], + [-1.2246467991473532e-16, -0.0, -1.0]] + self.assertListEqual(vals, truevals) + + def test_h0_p0_r180(self): + vals = rotation_matrix(heading=0, pitch=180, roll=0).tolist() + truevals = [[-1.0, 0.0, 1.2246467991473532e-16], + [-0.0, 1.0, 0.0], + [-1.2246467991473532e-16, -0.0, -1.0]] + self.assertListEqual(vals, truevals) + + +class TestRotate2d(TestCase): + + def test_rotate_0deg(self): + vals = list(rotate_2d(x=1, y=0, angle_deg=0)) + truevals = [1.0, 0.0] + self.assertListEqual(vals, truevals) + + def test_rotate_90deg(self): + vals = list(rotate_2d(x=1, y=0, angle_deg=90)) + truevals = [6.123233995736766e-17, 1.0] + self.assertListEqual(vals, truevals) + + def test_rotate_180deg(self): + vals = list(rotate_2d(x=1, y=0, angle_deg=180)) + truevals = [-1.0, 1.2246467991473532e-16] + self.assertListEqual(vals, truevals) + + def test_rotate_360deg(self): + vals = list(rotate_2d(x=1, y=0, angle_deg=360)) + truevals = [1.0, -2.4492935982947064e-16] + self.assertListEqual(vals, truevals) + + +class TestSpaceLine(TestCase): + + def test_space_line(self): + vals = spaceline((2, 0, 0), (3, 0, 0), num=5).tolist() + truevals = [[2., 0., 0.], + [2.25, 0., 0.], + [2.5, 0., 0.], + [2.75, 0., 0.], + [3., 0., 0.]] + self.assertListEqual(vals, truevals) + + +class TestArgsFlat(TestCase): + + def test_1_vector_and_2_scalar_args(self): + x = [1, 2, 3] + pos, c_shape = args_flat(x, 2, 3) + truepos = [[1, 2, 3], + [2, 2, 3], + [3, 2, 3]] + truec_shape = [3, ] + self.assertListEqual(pos.tolist(), truepos) + self.assertListEqual(list(c_shape), truec_shape) + + def test_1_vector_args(self): + pos1, c_shape1 = args_flat([1, 2, 3]) + truepos1 = [[1, 2, 3]] + truec_shape1 = None + self.assertListEqual(pos1.tolist(), truepos1) + self.assertIs(c_shape1, truec_shape1) + + def test_3_scalar_args(self): + pos1, c_shape1 = args_flat(1, 2, 3) + truepos1 = [[1, 2, 3]] + truec_shape1 = [] + self.assertListEqual(pos1.tolist(), truepos1) + self.assertListEqual(list(c_shape1), truec_shape1) + + def test_3_scalar_args_version2(self): + pos1, c_shape1 = args_flat([1], 2, 3) + truepos1 = [[1, 2, 3]] + truec_shape1 = [1, ] + self.assertListEqual(pos1.tolist(), truepos1) + self.assertListEqual(list(c_shape1), truec_shape1) + + +class TestSub2index2Sub(TestCase): + + def test_sub2index_and_index2sub(self): + shape = (3, 3, 4) + a = np.arange(np.prod(shape)).reshape(shape) + trueval = a[1, 2, 3] + order = 'C' + i = sub2index(shape, 1, 2, 3, order=order) + self.assertEquals(i, 23) + + val = a.ravel(order)[i] + self.assertEquals(val, trueval) + + sub = index2sub(shape, i, order=order) + for j, true_sub_j in enumerate([[1], [2], [3]]): + self.assertEquals(sub[j].tolist(), true_sub_j) + + +if __name__ == '__main__': + runner = local_unittest.TextTestRunner() # get_test_runner() + local_unittest.main(testRunner=runner)